C22H25ClN2O4 — CID 55926275
[2-[benzyl(propan-2-yl)amino]-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate (PubChem CID 55926275) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate.
| Compound Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 55926275 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] (2S)-2-[(2-chlorobenzoyl)amino]propanoate |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)COC(=O)[C@H](C)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H25ClN2O4/c1-15(2)25(13-17-9-5-4-6-10-17)20(26)14-29-22(28)16(3)24-21(27)18-11-7-8-12-19(18)23/h4-12,15-16H,13-14H2,1-3H3,(H,24,27)/t16-/m0/s1 |
| InChIKey | JEPMBSHAOCEDBC-INIZCTEOSA-N |
| XLogP | 3.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |