C26H27NO4 — CID 7277099
[2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 7277099) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 7277099 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [2-[benzyl(propan-2-yl)amino]-2-oxoethyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)COC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO4/c1-20(2)27(18-21-12-6-3-7-13-21)24(28)19-31-25(29)26(30,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,20,30H,18-19H2,1-2H3 |
| InChIKey | ALZJBBHGQNKGMQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |