C18H14Cl2F3NO4 — CID 55391580
[2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 55391580) has the molecular formula C18H14Cl2F3NO4 and a molecular weight of 436.21 g/mol. Its IUPAC name is [2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 55391580 |
| Molecular Formula | C18H14Cl2F3NO4 |
| Molecular Weight | 436.21 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | [2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-2-oxoethyl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)COC(=O)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H14Cl2F3NO4/c1-24(8-10-2-4-11(5-3-10)28-18(22)23)16(25)9-27-17(26)12-6-15(21)14(20)7-13(12)19/h2-7,18H,8-9H2,1H3 |
| InChIKey | IWRDNAPZZFBGTK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.21 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|