C20H21F2NO5 — CID 55315086
[2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-2-oxoethyl] 2-ethoxybenzoate (PubChem CID 55315086) has the molecular formula C20H21F2NO5 and a molecular weight of 393.39 g/mol. Its IUPAC name is [2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-2-oxoethyl] 2-ethoxybenzoate.
| Compound Name | [2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-2-oxoethyl] 2-ethoxybenzoate |
|---|---|
| PubChem CID | 55315086 |
| Molecular Formula | C20H21F2NO5 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-2-oxoethyl] 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)OCC(=O)N(C)Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H21F2NO5/c1-3-26-17-7-5-4-6-16(17)19(25)27-13-18(24)23(2)12-14-8-10-15(11-9-14)28-20(21)22/h4-11,20H,3,12-13H2,1-2H3 |
| InChIKey | KAXBITZGMJUUKA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |