C20H24N2O4 — CID 7671181
[2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-(methylamino)benzoate (PubChem CID 7671181) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is [2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-(methylamino)benzoate.
| Compound Name | [2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-(methylamino)benzoate |
|---|---|
| PubChem CID | 7671181 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-(methylamino)benzoate |
| SMILES | CCOc1ccc(CN(C)C(=O)COC(=O)c2ccccc2NC)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-4-25-16-11-9-15(10-12-16)13-22(3)19(23)14-26-20(24)17-7-5-6-8-18(17)21-2/h5-12,21H,4,13-14H2,1-3H3 |
| InChIKey | DNTPDIUWBYVMPA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |