C20H23NO5 — CID 7771822
[2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-hydroxy-5-methylbenzoate (PubChem CID 7771822) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-hydroxy-5-methylbenzoate.
| Compound Name | [2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-hydroxy-5-methylbenzoate |
|---|---|
| PubChem CID | 7771822 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 2-hydroxy-5-methylbenzoate |
| SMILES | CCOc1ccc(CN(C)C(=O)COC(=O)c2cc(C)ccc2O)cc1 |
| InChI | InChI=1S/C20H23NO5/c1-4-25-16-8-6-15(7-9-16)12-21(3)19(23)13-26-20(24)17-11-14(2)5-10-18(17)22/h5-11,22H,4,12-13H2,1-3H3 |
| InChIKey | FMWUBDLUPZFVMO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |