C11H9F3O4 — CID 107685215
ethyl 2,2-difluoro-2-(2-fluoro-4-formylphenoxy)acetate (PubChem CID 107685215) has the molecular formula C11H9F3O4 and a molecular weight of 262.18 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-(2-fluoro-4-formylphenoxy)acetate.
| Compound Name | ethyl 2,2-difluoro-2-(2-fluoro-4-formylphenoxy)acetate |
|---|---|
| PubChem CID | 107685215 |
| Molecular Formula | C11H9F3O4 |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | ethyl 2,2-difluoro-2-(2-fluoro-4-formylphenoxy)acetate |
| SMILES | CCOC(=O)C(F)(F)Oc1ccc(C=O)cc1F |
| InChI | InChI=1S/C11H9F3O4/c1-2-17-10(16)11(13,14)18-9-4-3-7(6-15)5-8(9)12/h3-6H,2H2,1H3 |
| InChIKey | RGKHQVQQUGQOQC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|