C11H12FNO3 — CID 103850142
2-(2-fluoro-4-formylphenoxy)-N,N-dimethylacetamide (PubChem CID 103850142) has the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. Its IUPAC name is 2-(2-fluoro-4-formylphenoxy)-N,N-dimethylacetamide.
| Compound Name | 2-(2-fluoro-4-formylphenoxy)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 103850142 |
| Molecular Formula | C11H12FNO3 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-(2-fluoro-4-formylphenoxy)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COc1ccc(C=O)cc1F |
| InChI | InChI=1S/C11H12FNO3/c1-13(2)11(15)7-16-10-4-3-8(6-14)5-9(10)12/h3-6H,7H2,1-2H3 |
| InChIKey | ATDYZQRDXCCHKE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|