C11H15FN2O2 — CID 107665283
2-[4-(aminomethyl)-2-fluorophenoxy]-N,N-dimethylacetamide (PubChem CID 107665283) has the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-2-fluorophenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(aminomethyl)-2-fluorophenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 107665283 |
| Molecular Formula | C11H15FN2O2 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-[4-(aminomethyl)-2-fluorophenoxy]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COc1ccc(CN)cc1F |
| InChI | InChI=1S/C11H15FN2O2/c1-14(2)11(15)7-16-10-4-3-8(6-13)5-9(10)12/h3-5H,6-7,13H2,1-2H3 |
| InChIKey | YZTCGZUXQHGJAC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |