C11H9F4NO3 — CID 113338147
2-(2-fluoro-4-formylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 113338147) has the molecular formula C11H9F4NO3 and a molecular weight of 279.19 g/mol. Its IUPAC name is 2-(2-fluoro-4-formylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(2-fluoro-4-formylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 113338147 |
| Molecular Formula | C11H9F4NO3 |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-(2-fluoro-4-formylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=Cc1ccc(OCC(=O)NCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C11H9F4NO3/c12-8-3-7(4-17)1-2-9(8)19-5-10(18)16-6-11(13,14)15/h1-4H,5-6H2,(H,16,18) |
| InChIKey | ALHSFCJHPYLTIE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|