C10H10F4N2O4S — CID 82917421
2-(4-fluoro-2-sulfamoylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 82917421) has the molecular formula C10H10F4N2O4S and a molecular weight of 330.26 g/mol. Its IUPAC name is 2-(4-fluoro-2-sulfamoylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(4-fluoro-2-sulfamoylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 82917421 |
| Molecular Formula | C10H10F4N2O4S |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-(4-fluoro-2-sulfamoylphenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | NS(=O)(=O)c1cc(F)ccc1OCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C10H10F4N2O4S/c11-6-1-2-7(8(3-6)21(15,18)19)20-4-9(17)16-5-10(12,13)14/h1-3H,4-5H2,(H,16,17)(H2,15,18,19) |
| InChIKey | QHLPVKZKMJIEJQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |