C11H13F3N2O3 — CID 61492512
2-(5-amino-2-methoxyphenoxy)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 61492512) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 2-(5-amino-2-methoxyphenoxy)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(5-amino-2-methoxyphenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 61492512 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-(5-amino-2-methoxyphenoxy)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | COc1ccc(N)cc1OCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O3/c1-18-8-3-2-7(15)4-9(8)19-5-10(17)16-6-11(12,13)14/h2-4H,5-6,15H2,1H3,(H,16,17) |
| InChIKey | XWKKBDMOHQQMHX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|