C11H15FN2O4S — CID 82915136
4-(4-fluoro-2-sulfamoylphenoxy)-N-methylbutanamide (PubChem CID 82915136) has the molecular formula C11H15FN2O4S and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-(4-fluoro-2-sulfamoylphenoxy)-N-methylbutanamide.
| Compound Name | 4-(4-fluoro-2-sulfamoylphenoxy)-N-methylbutanamide |
|---|---|
| PubChem CID | 82915136 |
| Molecular Formula | C11H15FN2O4S |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-(4-fluoro-2-sulfamoylphenoxy)-N-methylbutanamide |
| SMILES | CNC(=O)CCCOc1ccc(F)cc1S(N)(=O)=O |
| InChI | InChI=1S/C11H15FN2O4S/c1-14-11(15)3-2-6-18-9-5-4-8(12)7-10(9)19(13,16)17/h4-5,7H,2-3,6H2,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | ACYYVCGDWNKJLI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|