C8H8FNO5S — CID 62103698
2-(4-fluoro-2-sulfamoylphenoxy)acetic acid (PubChem CID 62103698) has the molecular formula C8H8FNO5S and a molecular weight of 249.22 g/mol. Its IUPAC name is 2-(4-fluoro-2-sulfamoylphenoxy)acetic acid.
| Compound Name | 2-(4-fluoro-2-sulfamoylphenoxy)acetic acid |
|---|---|
| PubChem CID | 62103698 |
| Molecular Formula | C8H8FNO5S |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 2-(4-fluoro-2-sulfamoylphenoxy)acetic acid |
| SMILES | NS(=O)(=O)c1cc(F)ccc1OCC(=O)O |
| InChI | InChI=1S/C8H8FNO5S/c9-5-1-2-6(15-4-8(11)12)7(3-5)16(10,13)14/h1-3H,4H2,(H,11,12)(H2,10,13,14) |
| InChIKey | RKMIQTQQDYBUDW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |