C12H15FN2O5S — CID 82915954
5-fluoro-2-(2-morpholin-4-yl-2-oxoethoxy)benzenesulfonamide (PubChem CID 82915954) has the molecular formula C12H15FN2O5S and a molecular weight of 318.33 g/mol. Its IUPAC name is 5-fluoro-2-(2-morpholin-4-yl-2-oxoethoxy)benzenesulfonamide.
| Compound Name | 5-fluoro-2-(2-morpholin-4-yl-2-oxoethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 82915954 |
| Molecular Formula | C12H15FN2O5S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 5-fluoro-2-(2-morpholin-4-yl-2-oxoethoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc(F)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C12H15FN2O5S/c13-9-1-2-10(11(7-9)21(14,17)18)20-8-12(16)15-3-5-19-6-4-15/h1-2,7H,3-6,8H2,(H2,14,17,18) |
| InChIKey | MOGTZPAFZGMUGO-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |