C13H14BrNO4 — CID 4288065
3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)benzaldehyde (PubChem CID 4288065) has the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. Its IUPAC name is 3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)benzaldehyde.
| Compound Name | 3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)benzaldehyde |
|---|---|
| PubChem CID | 4288065 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)benzaldehyde |
| SMILES | O=Cc1ccc(OCC(=O)N2CCOCC2)c(Br)c1 |
| InChI | InChI=1S/C13H14BrNO4/c14-11-7-10(8-16)1-2-12(11)19-9-13(17)15-3-5-18-6-4-15/h1-2,7-8H,3-6,9H2 |
| InChIKey | SLUZUIWCAKABPH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|