C23H27BrN2O3 — CID 126375425
2-[2-bromo-4-[(4-tert-butylphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 126375425) has the molecular formula C23H27BrN2O3 and a molecular weight of 459.38 g/mol. Its IUPAC name is 2-[2-bromo-4-[(4-tert-butylphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-bromo-4-[(4-tert-butylphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 126375425 |
| Molecular Formula | C23H27BrN2O3 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-[2-bromo-4-[(4-tert-butylphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | CC(C)(C)c1ccc(/N=C/c2ccc(OCC(=O)N3CCOCC3)c(Br)c2)cc1 |
| InChI | InChI=1S/C23H27BrN2O3/c1-23(2,3)18-5-7-19(8-6-18)25-15-17-4-9-21(20(24)14-17)29-16-22(27)26-10-12-28-13-11-26/h4-9,14-15H,10-13,16H2,1-3H3/b25-15+ |
| InChIKey | UFSNIDSPAKFTJD-MFKUBSTISA-N |
| XLogP | 4.73 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|