C29H33BrN2O3 — CID 126379591
2-[4-[[4-(1-adamantyl)phenyl]iminomethyl]-2-bromophenoxy]-1-morpholin-4-ylethanone (PubChem CID 126379591) has the molecular formula C29H33BrN2O3 and a molecular weight of 537.50 g/mol. Its IUPAC name is 2-[4-[[4-(1-adamantyl)phenyl]iminomethyl]-2-bromophenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[[4-(1-adamantyl)phenyl]iminomethyl]-2-bromophenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 126379591 |
| Molecular Formula | C29H33BrN2O3 |
| Molecular Weight | 537.50 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 2-[4-[[4-(1-adamantyl)phenyl]iminomethyl]-2-bromophenoxy]-1-morpholin-4-ylethanone |
| SMILES | O=C(COc1ccc(/C=N/c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)cc1Br)N1CCOCC1 |
| InChI | InChI=1S/C29H33BrN2O3/c30-26-14-20(1-6-27(26)35-19-28(33)32-7-9-34-10-8-32)18-31-25-4-2-24(3-5-25)29-15-21-11-22(16-29)13-23(12-21)17-29/h1-6,14,18,21-23H,7-13,15-17,19H2/b31-18+ |
| InChIKey | CUOLGEKRAPEAJW-FDAWAROLSA-N |
| XLogP | 5.91 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|