C20H20Br2N2O3 — CID 126384851
2-[2-bromo-4-[(2-bromo-4-methylphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 126384851) has the molecular formula C20H20Br2N2O3 and a molecular weight of 496.20 g/mol. Its IUPAC name is 2-[2-bromo-4-[(2-bromo-4-methylphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-bromo-4-[(2-bromo-4-methylphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 126384851 |
| Molecular Formula | C20H20Br2N2O3 |
| Molecular Weight | 496.20 g/mol |
| Exact Mass | 493.98 |
| IUPAC Name | 2-[2-bromo-4-[(2-bromo-4-methylphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | Cc1ccc(/N=C/c2ccc(OCC(=O)N3CCOCC3)c(Br)c2)c(Br)c1 |
| InChI | InChI=1S/C20H20Br2N2O3/c1-14-2-4-18(16(21)10-14)23-12-15-3-5-19(17(22)11-15)27-13-20(25)24-6-8-26-9-7-24/h2-5,10-12H,6-9,13H2,1H3/b23-12+ |
| InChIKey | AWSCQVQSYQJZSV-FSJBWODESA-N |
| XLogP | 4.51 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.20 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|