C26H25BrN2O5 — CID 126382780
2-[2-bromo-4-[[4-(2-methoxyphenoxy)phenyl]iminomethyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 126382780) has the molecular formula C26H25BrN2O5 and a molecular weight of 525.40 g/mol. Its IUPAC name is 2-[2-bromo-4-[[4-(2-methoxyphenoxy)phenyl]iminomethyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-bromo-4-[[4-(2-methoxyphenoxy)phenyl]iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 126382780 |
| Molecular Formula | C26H25BrN2O5 |
| Molecular Weight | 525.40 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | 2-[2-bromo-4-[[4-(2-methoxyphenoxy)phenyl]iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | COc1ccccc1Oc1ccc(/N=C/c2ccc(OCC(=O)N3CCOCC3)c(Br)c2)cc1 |
| InChI | InChI=1S/C26H25BrN2O5/c1-31-24-4-2-3-5-25(24)34-21-9-7-20(8-10-21)28-17-19-6-11-23(22(27)16-19)33-18-26(30)29-12-14-32-15-13-29/h2-11,16-17H,12-15,18H2,1H3/b28-17+ |
| InChIKey | NFNQMPMQQTWMSG-OGLMXYFKSA-N |
| XLogP | 5.24 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|