C20H21BrN2O4 — CID 1276387
methyl 2-[2-bromo-4-[(4-morpholin-4-ylphenyl)iminomethyl]phenoxy]acetate (PubChem CID 1276387) has the molecular formula C20H21BrN2O4 and a molecular weight of 433.30 g/mol. Its IUPAC name is methyl 2-[2-bromo-4-[(4-morpholin-4-ylphenyl)iminomethyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-4-[(4-morpholin-4-ylphenyl)iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 1276387 |
| Molecular Formula | C20H21BrN2O4 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | methyl 2-[2-bromo-4-[(4-morpholin-4-ylphenyl)iminomethyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=N/c2ccc(N3CCOCC3)cc2)cc1Br |
| InChI | InChI=1S/C20H21BrN2O4/c1-25-20(24)14-27-19-7-2-15(12-18(19)21)13-22-16-3-5-17(6-4-16)23-8-10-26-11-9-23/h2-7,12-13H,8-11,14H2,1H3/b22-13+ |
| InChIKey | BNQKEOPZJXPBCL-LPYMAVHISA-N |
| XLogP | 3.59 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|