C20H21BrN2O3S — CID 126383418
2-[2-bromo-4-[(2-methylsulfanylphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 126383418) has the molecular formula C20H21BrN2O3S and a molecular weight of 449.37 g/mol. Its IUPAC name is 2-[2-bromo-4-[(2-methylsulfanylphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-bromo-4-[(2-methylsulfanylphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 126383418 |
| Molecular Formula | C20H21BrN2O3S |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 2-[2-bromo-4-[(2-methylsulfanylphenyl)iminomethyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | CSc1ccccc1/N=C/c1ccc(OCC(=O)N2CCOCC2)c(Br)c1 |
| InChI | InChI=1S/C20H21BrN2O3S/c1-27-19-5-3-2-4-17(19)22-13-15-6-7-18(16(21)12-15)26-14-20(24)23-8-10-25-11-9-23/h2-7,12-13H,8-11,14H2,1H3/b22-13+ |
| InChIKey | SFLZJANZFGQBQN-LPYMAVHISA-N |
| XLogP | 4.16 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|