C22H20BrN3O5 — CID 3269861
N-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide (PubChem CID 3269861) has the molecular formula C22H20BrN3O5 and a molecular weight of 486.32 g/mol. Its IUPAC name is N-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide.
| Compound Name | N-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 3269861 |
| Molecular Formula | C22H20BrN3O5 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | N-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NN=Cc1ccc(OCC(=O)N2CCOCC2)c(Br)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C22H20BrN3O5/c23-17-11-15(5-6-19(17)30-14-21(27)26-7-9-29-10-8-26)13-24-25-22(28)20-12-16-3-1-2-4-18(16)31-20/h1-6,11-13H,7-10,14H2,(H,25,28) |
| InChIKey | OIZFJCVAUVXMMB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|