C18H18BrN3O5 — CID 4315941
N-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]furan-2-carboxamide (PubChem CID 4315941) has the molecular formula C18H18BrN3O5 and a molecular weight of 436.26 g/mol. Its IUPAC name is N-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]furan-2-carboxamide.
| Compound Name | N-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 4315941 |
| Molecular Formula | C18H18BrN3O5 |
| Molecular Weight | 436.26 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | N-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylideneamino]furan-2-carboxamide |
| SMILES | O=C(NN=Cc1ccc(OCC(=O)N2CCOCC2)c(Br)c1)c1ccco1 |
| InChI | InChI=1S/C18H18BrN3O5/c19-14-10-13(11-20-21-18(24)16-2-1-7-26-16)3-4-15(14)27-12-17(23)22-5-8-25-9-6-22/h1-4,7,10-11H,5-6,8-9,12H2,(H,21,24) |
| InChIKey | KEXINEFOVYOICJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|