C19H14BrClN2O5 — CID 1278903
methyl 2-[4-[(1-benzofuran-2-carbonylhydrazinylidene)methyl]-2-bromo-6-chlorophenoxy]acetate (PubChem CID 1278903) has the molecular formula C19H14BrClN2O5 and a molecular weight of 465.69 g/mol. Its IUPAC name is methyl 2-[4-[(1-benzofuran-2-carbonylhydrazinylidene)methyl]-2-bromo-6-chlorophenoxy]acetate.
| Compound Name | methyl 2-[4-[(1-benzofuran-2-carbonylhydrazinylidene)methyl]-2-bromo-6-chlorophenoxy]acetate |
|---|---|
| PubChem CID | 1278903 |
| Molecular Formula | C19H14BrClN2O5 |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | methyl 2-[4-[(1-benzofuran-2-carbonylhydrazinylidene)methyl]-2-bromo-6-chlorophenoxy]acetate |
| SMILES | COC(=O)COc1c(Cl)cc(C=NNC(=O)c2cc3ccccc3o2)cc1Br |
| InChI | InChI=1S/C19H14BrClN2O5/c1-26-17(24)10-27-18-13(20)6-11(7-14(18)21)9-22-23-19(25)16-8-12-4-2-3-5-15(12)28-16/h2-9H,10H2,1H3,(H,23,25) |
| InChIKey | JXPJPUMPIIUJDP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|