C18H10Br3ClN2O5 — CID 21375797
2-[2-bromo-6-chloro-4-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 21375797) has the molecular formula C18H10Br3ClN2O5 and a molecular weight of 609.45 g/mol. Its IUPAC name is 2-[2-bromo-6-chloro-4-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-chloro-4-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 21375797 |
| Molecular Formula | C18H10Br3ClN2O5 |
| Molecular Weight | 609.45 g/mol |
| Exact Mass | 605.78 |
| IUPAC Name | 2-[2-bromo-6-chloro-4-[(Z)-[(5,7-dibromo-1-benzofuran-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Cl)cc(/C=N\NC(=O)c2cc3cc(Br)cc(Br)c3o2)cc1Br |
| InChI | InChI=1S/C18H10Br3ClN2O5/c19-10-3-9-4-14(29-16(9)12(21)5-10)18(27)24-23-6-8-1-11(20)17(13(22)2-8)28-7-15(25)26/h1-6H,7H2,(H,24,27)(H,25,26)/b23-6- |
| InChIKey | IVXWZDVBSFRHAX-OUBWWKSTSA-N |
| XLogP | 5.60 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.45 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|