C25H24BrN3O5S — CID 126388760
(5E)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126388760) has the molecular formula C25H24BrN3O5S and a molecular weight of 558.45 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126388760 |
| Molecular Formula | C25H24BrN3O5S |
| Molecular Weight | 558.45 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | (5E)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1-(2,4-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccc(N2C(=O)/C(=C/c3ccc(OCC(=O)N4CCOCC4)c(Br)c3)C(=O)NC2=S)c(C)c1 |
| InChI | InChI=1S/C25H24BrN3O5S/c1-15-3-5-20(16(2)11-15)29-24(32)18(23(31)27-25(29)35)12-17-4-6-21(19(26)13-17)34-14-22(30)28-7-9-33-10-8-28/h3-6,11-13H,7-10,14H2,1-2H3,(H,27,31,35)/b18-12+ |
| InChIKey | AVMDCHRCGCTVMW-LDADJPATSA-N |
| XLogP | 3.13 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|