C23H22BrN3O4 — CID 4313647
4-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 4313647) has the molecular formula C23H22BrN3O4 and a molecular weight of 484.35 g/mol. Its IUPAC name is 4-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 4313647 |
| Molecular Formula | C23H22BrN3O4 |
| Molecular Weight | 484.35 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 4-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1=Cc1ccc(OCC(=O)N2CCOCC2)c(Br)c1 |
| InChI | InChI=1S/C23H22BrN3O4/c1-16-19(23(29)27(25-16)18-5-3-2-4-6-18)13-17-7-8-21(20(24)14-17)31-15-22(28)26-9-11-30-12-10-26/h2-8,13-14H,9-12,15H2,1H3 |
| InChIKey | XFPDFIMKOYZJOZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|