C22H23BrN2O2 — CID 27526337
(4Z)-4-[[3-bromo-4-[(2S)-2-methylbutoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 27526337) has the molecular formula C22H23BrN2O2 and a molecular weight of 427.34 g/mol. Its IUPAC name is (4Z)-4-[[3-bromo-4-[(2S)-2-methylbutoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | (4Z)-4-[[3-bromo-4-[(2S)-2-methylbutoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 27526337 |
| Molecular Formula | C22H23BrN2O2 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | (4Z)-4-[[3-bromo-4-[(2S)-2-methylbutoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | CC[C@H](C)COc1ccc(/C=C2\C(=O)N(c3ccccc3)N=C2C)cc1Br |
| InChI | InChI=1S/C22H23BrN2O2/c1-4-15(2)14-27-21-11-10-17(13-20(21)23)12-19-16(3)24-25(22(19)26)18-8-6-5-7-9-18/h5-13,15H,4,14H2,1-3H3/b19-12-/t15-/m0/s1 |
| InChIKey | UASYUVIHYUYAAC-CCRNYGKSSA-N |
| XLogP | 5.68 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|