C24H17BrN2O4 — CID 126098723
2-[2-bromo-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]acetic acid (PubChem CID 126098723) has the molecular formula C24H17BrN2O4 and a molecular weight of 477.31 g/mol. Its IUPAC name is 2-[2-bromo-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126098723 |
| Molecular Formula | C24H17BrN2O4 |
| Molecular Weight | 477.31 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 2-[2-bromo-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)cc1Br |
| InChI | InChI=1S/C24H17BrN2O4/c25-20-14-16(11-12-21(20)31-15-22(28)29)13-19-23(17-7-3-1-4-8-17)26-27(24(19)30)18-9-5-2-6-10-18/h1-14H,15H2,(H,28,29)/b19-13- |
| InChIKey | UZZWOCOURCSOIP-UYRXBGFRSA-N |
| XLogP | 4.75 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.31 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|