C24H16Br2N2O4 — CID 126084590
2-[2,6-dibromo-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]acetic acid (PubChem CID 126084590) has the molecular formula C24H16Br2N2O4 and a molecular weight of 556.21 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126084590 |
| Molecular Formula | C24H16Br2N2O4 |
| Molecular Weight | 556.21 g/mol |
| Exact Mass | 553.95 |
| IUPAC Name | 2-[2,6-dibromo-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Br)cc(/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)cc1Br |
| InChI | InChI=1S/C24H16Br2N2O4/c25-19-12-15(13-20(26)23(19)32-14-21(29)30)11-18-22(16-7-3-1-4-8-16)27-28(24(18)31)17-9-5-2-6-10-17/h1-13H,14H2,(H,29,30)/b18-11- |
| InChIKey | HMLRRXPPMWHUMD-WQRHYEAKSA-N |
| XLogP | 5.51 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.21 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|