C30H22BrClN2O5S — CID 126098558
[2-bromo-6-ethoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126098558) has the molecular formula C30H22BrClN2O5S and a molecular weight of 637.94 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-bromo-6-ethoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126098558 |
| Molecular Formula | C30H22BrClN2O5S |
| Molecular Weight | 637.94 g/mol |
| Exact Mass | 636.01 |
| IUPAC Name | [2-bromo-6-ethoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | CCOc1cc(/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)cc(Br)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H22BrClN2O5S/c1-2-38-27-19-20(18-26(31)29(27)39-40(36,37)24-15-13-22(32)14-16-24)17-25-28(21-9-5-3-6-10-21)33-34(30(25)35)23-11-7-4-8-12-23/h3-19H,2H2,1H3/b25-17- |
| InChIKey | SZULGMGGUGXDDD-UQQQWYQISA-N |
| XLogP | 7.10 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.94 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|