C24H19ClN2O2 — CID 126093870
(4Z)-4-[(3-chloro-4-ethoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one (PubChem CID 126093870) has the molecular formula C24H19ClN2O2 and a molecular weight of 402.88 g/mol. Its IUPAC name is (4Z)-4-[(3-chloro-4-ethoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one.
| Compound Name | (4Z)-4-[(3-chloro-4-ethoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 126093870 |
| Molecular Formula | C24H19ClN2O2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (4Z)-4-[(3-chloro-4-ethoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one |
| SMILES | CCOc1ccc(/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)cc1Cl |
| InChI | InChI=1S/C24H19ClN2O2/c1-2-29-22-14-13-17(16-21(22)25)15-20-23(18-9-5-3-6-10-18)26-27(24(20)28)19-11-7-4-8-12-19/h3-16H,2H2,1H3/b20-15- |
| InChIKey | ZBMADBRETORIKA-HKWRFOASSA-N |
| XLogP | 5.57 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|