C29H19Cl3N2O2 — CID 126098907
(4Z)-4-[[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,5-diphenylpyrazol-3-one (PubChem CID 126098907) has the molecular formula C29H19Cl3N2O2 and a molecular weight of 533.84 g/mol. Its IUPAC name is (4Z)-4-[[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,5-diphenylpyrazol-3-one.
| Compound Name | (4Z)-4-[[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 126098907 |
| Molecular Formula | C29H19Cl3N2O2 |
| Molecular Weight | 533.84 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | (4Z)-4-[[3,5-dichloro-4-[(4-chlorophenyl)methoxy]phenyl]methylidene]-2,5-diphenylpyrazol-3-one |
| SMILES | O=C1/C(=C\c2cc(Cl)c(OCc3ccc(Cl)cc3)c(Cl)c2)C(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C29H19Cl3N2O2/c30-22-13-11-19(12-14-22)18-36-28-25(31)16-20(17-26(28)32)15-24-27(21-7-3-1-4-8-21)33-34(29(24)35)23-9-5-2-6-10-23/h1-17H,18H2/b24-15- |
| InChIKey | VKLSTJGFSALDAT-IWIPYMOSSA-N |
| XLogP | 8.06 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.84 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|