C30H22BrFN2O3 — CID 126091463
(4Z)-4-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,5-diphenylpyrazol-3-one (PubChem CID 126091463) has the molecular formula C30H22BrFN2O3 and a molecular weight of 557.42 g/mol. Its IUPAC name is (4Z)-4-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,5-diphenylpyrazol-3-one.
| Compound Name | (4Z)-4-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 126091463 |
| Molecular Formula | C30H22BrFN2O3 |
| Molecular Weight | 557.42 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | (4Z)-4-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,5-diphenylpyrazol-3-one |
| SMILES | COc1cc(/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)cc(Br)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C30H22BrFN2O3/c1-36-27-18-21(17-26(31)29(27)37-19-20-12-14-23(32)15-13-20)16-25-28(22-8-4-2-5-9-22)33-34(30(25)35)24-10-6-3-7-11-24/h2-18H,19H2,1H3/b25-16- |
| InChIKey | WOLOBCXMDJPJIQ-XYGWBWBKSA-N |
| XLogP | 7.01 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.42 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|