C24H17Br2FN2O2 — CID 50872813
(4E)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 50872813) has the molecular formula C24H17Br2FN2O2 and a molecular weight of 544.22 g/mol. Its IUPAC name is (4E)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | (4E)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 50872813 |
| Molecular Formula | C24H17Br2FN2O2 |
| Molecular Weight | 544.22 g/mol |
| Exact Mass | 541.96 |
| IUPAC Name | (4E)-4-[[3,5-dibromo-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C/c1cc(Br)c(OCc2ccc(F)cc2)c(Br)c1 |
| InChI | InChI=1S/C24H17Br2FN2O2/c1-15-20(24(30)29(28-15)19-5-3-2-4-6-19)11-17-12-21(25)23(22(26)13-17)31-14-16-7-9-18(27)10-8-16/h2-13H,14H2,1H3/b20-11+ |
| InChIKey | KFDGWNBQVMKOOQ-RGVLZGJSSA-N |
| XLogP | 6.74 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.22 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|