C30H22Cl2N2O2 — CID 126087199
(4Z)-4-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,5-diphenylpyrazol-3-one (PubChem CID 126087199) has the molecular formula C30H22Cl2N2O2 and a molecular weight of 513.42 g/mol. Its IUPAC name is (4Z)-4-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,5-diphenylpyrazol-3-one.
| Compound Name | (4Z)-4-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 126087199 |
| Molecular Formula | C30H22Cl2N2O2 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | (4Z)-4-[[3,5-dichloro-2-[(4-methylphenyl)methoxy]phenyl]methylidene]-2,5-diphenylpyrazol-3-one |
| SMILES | Cc1ccc(COc2c(Cl)cc(Cl)cc2/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C30H22Cl2N2O2/c1-20-12-14-21(15-13-20)19-36-29-23(16-24(31)18-27(29)32)17-26-28(22-8-4-2-5-9-22)33-34(30(26)35)25-10-6-3-7-11-25/h2-18H,19H2,1H3/b26-17- |
| InChIKey | NUGJLLOQUWFGOS-ONUIUJJFSA-N |
| XLogP | 7.72 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|