C29H22N2O2 — CID 126086220
(4Z)-2,5-diphenyl-4-[(2-phenylmethoxyphenyl)methylidene]pyrazol-3-one (PubChem CID 126086220) has the molecular formula C29H22N2O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is (4Z)-2,5-diphenyl-4-[(2-phenylmethoxyphenyl)methylidene]pyrazol-3-one.
| Compound Name | (4Z)-2,5-diphenyl-4-[(2-phenylmethoxyphenyl)methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 126086220 |
| Molecular Formula | C29H22N2O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (4Z)-2,5-diphenyl-4-[(2-phenylmethoxyphenyl)methylidene]pyrazol-3-one |
| SMILES | O=C1/C(=C\c2ccccc2OCc2ccccc2)C(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C29H22N2O2/c32-29-26(20-24-16-10-11-19-27(24)33-21-22-12-4-1-5-13-22)28(23-14-6-2-7-15-23)30-31(29)25-17-8-3-9-18-25/h1-20H,21H2/b26-20- |
| InChIKey | BVGXZUKCSCJNLF-QOMWVZHYSA-N |
| XLogP | 6.10 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|