C28H28N2O2 — CID 5290582
(4E)-4-[(2-hexoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one (PubChem CID 5290582) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is (4E)-4-[(2-hexoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one.
| Compound Name | (4E)-4-[(2-hexoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 5290582 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (4E)-4-[(2-hexoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one |
| SMILES | CCCCCCOc1ccccc1/C=C1/C(=O)N(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C28H28N2O2/c1-2-3-4-13-20-32-26-19-12-11-16-23(26)21-25-27(22-14-7-5-8-15-22)29-30(28(25)31)24-17-9-6-10-18-24/h5-12,14-19,21H,2-4,13,20H2,1H3/b25-21+ |
| InChIKey | DJYSWXGGKMJQTC-NJNXFGOHSA-N |
| XLogP | 6.48 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|