C29H29N3O4 — CID 98068046
(4Z)-4-[(4-heptoxyphenyl)methylidene]-2-(4-nitrophenyl)-5-phenylpyrazol-3-one (PubChem CID 98068046) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is (4Z)-4-[(4-heptoxyphenyl)methylidene]-2-(4-nitrophenyl)-5-phenylpyrazol-3-one.
| Compound Name | (4Z)-4-[(4-heptoxyphenyl)methylidene]-2-(4-nitrophenyl)-5-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 98068046 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | (4Z)-4-[(4-heptoxyphenyl)methylidene]-2-(4-nitrophenyl)-5-phenylpyrazol-3-one |
| SMILES | CCCCCCCOc1ccc(/C=C2\C(=O)N(c3ccc([N+](=O)[O-])cc3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H29N3O4/c1-2-3-4-5-9-20-36-26-18-12-22(13-19-26)21-27-28(23-10-7-6-8-11-23)30-31(29(27)33)24-14-16-25(17-15-24)32(34)35/h6-8,10-19,21H,2-5,9,20H2,1H3/b27-21- |
| InChIKey | JPTKLBUVBBRNAS-MEFGMAGPSA-N |
| XLogP | 6.78 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|