C25H19N3O5 — CID 71833130
3-[4-[[2-(2-amino-2-oxoethoxy)phenyl]methylidene]-5-oxo-3-phenylpyrazol-1-yl]benzoic acid (PubChem CID 71833130) has the molecular formula C25H19N3O5 and a molecular weight of 441.44 g/mol. Its IUPAC name is 3-[4-[[2-(2-amino-2-oxoethoxy)phenyl]methylidene]-5-oxo-3-phenylpyrazol-1-yl]benzoic acid.
| Compound Name | 3-[4-[[2-(2-amino-2-oxoethoxy)phenyl]methylidene]-5-oxo-3-phenylpyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 71833130 |
| Molecular Formula | C25H19N3O5 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 3-[4-[[2-(2-amino-2-oxoethoxy)phenyl]methylidene]-5-oxo-3-phenylpyrazol-1-yl]benzoic acid |
| SMILES | NC(=O)COc1ccccc1C=C1C(=O)N(c2cccc(C(=O)O)c2)N=C1c1ccccc1 |
| InChI | InChI=1S/C25H19N3O5/c26-22(29)15-33-21-12-5-4-9-17(21)14-20-23(16-7-2-1-3-8-16)27-28(24(20)30)19-11-6-10-18(13-19)25(31)32/h1-14H,15H2,(H2,26,29)(H,31,32) |
| InChIKey | ZKLMCRXCQICAHE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|