C24H18N2O5 — CID 135628075
3-[(4Z)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-5-oxo-3-phenylpyrazol-1-yl]benzoic acid (PubChem CID 135628075) has the molecular formula C24H18N2O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is 3-[(4Z)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-5-oxo-3-phenylpyrazol-1-yl]benzoic acid.
| Compound Name | 3-[(4Z)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-5-oxo-3-phenylpyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 135628075 |
| Molecular Formula | C24H18N2O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 3-[(4Z)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-5-oxo-3-phenylpyrazol-1-yl]benzoic acid |
| SMILES | COc1cc(/C=C2\C(=O)N(c3cccc(C(=O)O)c3)N=C2c2ccccc2)ccc1O |
| InChI | InChI=1S/C24H18N2O5/c1-31-21-13-15(10-11-20(21)27)12-19-22(16-6-3-2-4-7-16)25-26(23(19)28)18-9-5-8-17(14-18)24(29)30/h2-14,27H,1H3,(H,29,30)/b19-12- |
| InChIKey | XMEGEMPYBOKOBI-UNOMPAQXSA-N |
| XLogP | 3.93 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|