C26H20N2O7 — CID 162663057
2-[2-(carboxymethoxy)-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]acetic acid (PubChem CID 162663057) has the molecular formula C26H20N2O7 and a molecular weight of 472.45 g/mol. Its IUPAC name is 2-[2-(carboxymethoxy)-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-(carboxymethoxy)-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 162663057 |
| Molecular Formula | C26H20N2O7 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 2-[2-(carboxymethoxy)-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)cc1OCC(=O)O |
| InChI | InChI=1S/C26H20N2O7/c29-23(30)15-34-21-12-11-17(14-22(21)35-16-24(31)32)13-20-25(18-7-3-1-4-8-18)27-28(26(20)33)19-9-5-2-6-10-19/h1-14H,15-16H2,(H,29,30)(H,31,32)/b20-13- |
| InChIKey | WHQATSIJZHUTQE-MOSHPQCFSA-N |
| XLogP | 3.45 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|