C24H19ClN2O3 — CID 137086153
(4Z)-4-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one (PubChem CID 137086153) has the molecular formula C24H19ClN2O3 and a molecular weight of 418.88 g/mol. Its IUPAC name is (4Z)-4-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one.
| Compound Name | (4Z)-4-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 137086153 |
| Molecular Formula | C24H19ClN2O3 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (4Z)-4-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one |
| SMILES | CCOc1cc(/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)cc(Cl)c1O |
| InChI | InChI=1S/C24H19ClN2O3/c1-2-30-21-15-16(14-20(25)23(21)28)13-19-22(17-9-5-3-6-10-17)26-27(24(19)29)18-11-7-4-8-12-18/h3-15,28H,2H2,1H3/b19-13- |
| InChIKey | ZUGSIKKLQGRQJF-UYRXBGFRSA-N |
| XLogP | 5.28 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|