C23H19BrFN3O6 — CID 126386617
(5E)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126386617) has the molecular formula C23H19BrFN3O6 and a molecular weight of 532.32 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126386617 |
| Molecular Formula | C23H19BrFN3O6 |
| Molecular Weight | 532.32 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | (5E)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccccc2F)C(=O)/C1=C/c1ccc(OCC(=O)N2CCOCC2)c(Br)c1 |
| InChI | InChI=1S/C23H19BrFN3O6/c24-16-12-14(5-6-19(16)34-13-20(29)27-7-9-33-10-8-27)11-15-21(30)26-23(32)28(22(15)31)18-4-2-1-3-17(18)25/h1-6,11-12H,7-10,13H2,(H,26,30,32)/b15-11+ |
| InChIKey | XJZGTAGHDCFPAM-RVDMUPIBSA-N |
| XLogP | 2.49 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|