C23H19Cl2N3O6 — CID 126237371
(5E)-1-(2,3-dichlorophenyl)-5-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126237371) has the molecular formula C23H19Cl2N3O6 and a molecular weight of 504.33 g/mol. Its IUPAC name is (5E)-1-(2,3-dichlorophenyl)-5-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(2,3-dichlorophenyl)-5-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126237371 |
| Molecular Formula | C23H19Cl2N3O6 |
| Molecular Weight | 504.33 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | (5E)-1-(2,3-dichlorophenyl)-5-[[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2cccc(Cl)c2Cl)C(=O)/C1=C/c1ccc(OCC(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H19Cl2N3O6/c24-17-2-1-3-18(20(17)25)28-22(31)16(21(30)26-23(28)32)12-14-4-6-15(7-5-14)34-13-19(29)27-8-10-33-11-9-27/h1-7,12H,8-11,13H2,(H,26,30,32)/b16-12+ |
| InChIKey | IODMKLXXJZWVBR-FOWTUZBSSA-N |
| XLogP | 2.90 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|