C23H21BrFN3O5 — CID 126374903
(5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126374903) has the molecular formula C23H21BrFN3O5 and a molecular weight of 518.34 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126374903 |
| Molecular Formula | C23H21BrFN3O5 |
| Molecular Weight | 518.34 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C(COc1ccc(/C=C2\NC(=O)N(Cc3ccccc3F)C2=O)cc1Br)N1CCOCC1 |
| InChI | InChI=1S/C23H21BrFN3O5/c24-17-11-15(5-6-20(17)33-14-21(29)27-7-9-32-10-8-27)12-19-22(30)28(23(31)26-19)13-16-3-1-2-4-18(16)25/h1-6,11-12H,7-10,13-14H2,(H,26,31)/b19-12- |
| InChIKey | NWSXXLJBCUOCCP-UNOMPAQXSA-N |
| XLogP | 2.92 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|