C19H13BrFN2O5- — CID 3628892
2-[4-bromo-2-[[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate (PubChem CID 3628892) has the molecular formula C19H13BrFN2O5- and a molecular weight of 448.22 g/mol. Its IUPAC name is 2-[4-bromo-2-[[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[4-bromo-2-[[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3628892 |
| Molecular Formula | C19H13BrFN2O5- |
| Molecular Weight | 448.22 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | 2-[4-bromo-2-[[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccc(Br)cc1C=C1NC(=O)N(Cc2ccccc2F)C1=O |
| InChI | InChI=1S/C19H14BrFN2O5/c20-13-5-6-16(28-10-17(24)25)12(7-13)8-15-18(26)23(19(27)22-15)9-11-3-1-2-4-14(11)21/h1-8H,9-10H2,(H,22,27)(H,24,25)/p-1 |
| InChIKey | XIBQULLGRCWDEZ-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|