C17H11FI2N2O3 — CID 126108818
(5E)-3-[(2-fluorophenyl)methyl]-5-[(2-hydroxy-3,5-diiodophenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 126108818) has the molecular formula C17H11FI2N2O3 and a molecular weight of 564.09 g/mol. Its IUPAC name is (5E)-3-[(2-fluorophenyl)methyl]-5-[(2-hydroxy-3,5-diiodophenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-fluorophenyl)methyl]-5-[(2-hydroxy-3,5-diiodophenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126108818 |
| Molecular Formula | C17H11FI2N2O3 |
| Molecular Weight | 564.09 g/mol |
| Exact Mass | 563.88 |
| IUPAC Name | (5E)-3-[(2-fluorophenyl)methyl]-5-[(2-hydroxy-3,5-diiodophenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cc(I)cc(I)c2O)C(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C17H11FI2N2O3/c18-12-4-2-1-3-9(12)8-22-16(24)14(21-17(22)25)6-10-5-11(19)7-13(20)15(10)23/h1-7,23H,8H2,(H,21,25)/b14-6+ |
| InChIKey | AFPKIMSNSKJRKT-MKMNVTDBSA-N |
| XLogP | 3.83 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.09 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|