C19H16ClFN2O4 — CID 2188404
(5Z)-5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 2188404) has the molecular formula C19H16ClFN2O4 and a molecular weight of 390.80 g/mol. Its IUPAC name is (5Z)-5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2188404 |
| Molecular Formula | C19H16ClFN2O4 |
| Molecular Weight | 390.80 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (5Z)-5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1cc(Cl)c(/C=C2\NC(=O)N(Cc3ccccc3F)C2=O)cc1OC |
| InChI | InChI=1S/C19H16ClFN2O4/c1-26-16-8-12(13(20)9-17(16)27-2)7-15-18(24)23(19(25)22-15)10-11-5-3-4-6-14(11)21/h3-9H,10H2,1-2H3,(H,22,25)/b15-7- |
| InChIKey | HXUMMKUTOJNUPB-CHHVJCJISA-N |
| XLogP | 3.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|